C13H20O2 — CID 175500089
1-(4-tert-butylphenyl)propane-2,2-diol (PubChem CID 175500089) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)propane-2,2-diol.
| Compound Name | 1-(4-tert-butylphenyl)propane-2,2-diol |
|---|---|
| PubChem CID | 175500089 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1-(4-tert-butylphenyl)propane-2,2-diol |
| SMILES | CC(O)(O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C13H20O2/c1-12(2,3)11-7-5-10(6-8-11)9-13(4,14)15/h5-8,14-15H,9H2,1-4H3 |
| InChIKey | YYGDDNFEIBKTFD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|