C25H36O2 — CID 11057694
2,2-bis[(4-tert-butylphenyl)methyl]propane-1,3-diol (PubChem CID 11057694) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 2,2-bis[(4-tert-butylphenyl)methyl]propane-1,3-diol.
| Compound Name | 2,2-bis[(4-tert-butylphenyl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 11057694 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 2,2-bis[(4-tert-butylphenyl)methyl]propane-1,3-diol |
| SMILES | CC(C)(C)c1ccc(CC(CO)(CO)Cc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H36O2/c1-23(2,3)21-11-7-19(8-12-21)15-25(17-26,18-27)16-20-9-13-22(14-10-20)24(4,5)6/h7-14,26-27H,15-18H2,1-6H3 |
| InChIKey | QVRCZGXIHHTQLS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |