C14H23NO — CID 117111989
2-[4-(2-amino-2-methylpropyl)phenyl]-2-methylpropan-1-ol (PubChem CID 117111989) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-[4-(2-amino-2-methylpropyl)phenyl]-2-methylpropan-1-ol.
| Compound Name | 2-[4-(2-amino-2-methylpropyl)phenyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 117111989 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-[4-(2-amino-2-methylpropyl)phenyl]-2-methylpropan-1-ol |
| SMILES | CC(C)(N)Cc1ccc(C(C)(C)CO)cc1 |
| InChI | InChI=1S/C14H23NO/c1-13(2,10-16)12-7-5-11(6-8-12)9-14(3,4)15/h5-8,16H,9-10,15H2,1-4H3 |
| InChIKey | KGBBKCRTDLWEBB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |