C14H16Br2O4 — CID 170340891
2-bromo-3-[4-(2-bromo-2-carboxypropyl)phenyl]-2-methylpropanoic acid (PubChem CID 170340891) has the molecular formula C14H16Br2O4 and a molecular weight of 408.09 g/mol. Its IUPAC name is 2-bromo-3-[4-(2-bromo-2-carboxypropyl)phenyl]-2-methylpropanoic acid.
| Compound Name | 2-bromo-3-[4-(2-bromo-2-carboxypropyl)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 170340891 |
| Molecular Formula | C14H16Br2O4 |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | 2-bromo-3-[4-(2-bromo-2-carboxypropyl)phenyl]-2-methylpropanoic acid |
| SMILES | CC(Br)(Cc1ccc(CC(C)(Br)C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C14H16Br2O4/c1-13(15,11(17)18)7-9-3-5-10(6-4-9)8-14(2,16)12(19)20/h3-6H,7-8H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | NNMFJPRLQVVANU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|