C12H14O4S — CID 54137671
2-methyl-2-[(4-methylsulfanylphenyl)methyl]propanedioic acid (PubChem CID 54137671) has the molecular formula C12H14O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-methyl-2-[(4-methylsulfanylphenyl)methyl]propanedioic acid.
| Compound Name | 2-methyl-2-[(4-methylsulfanylphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 54137671 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-methyl-2-[(4-methylsulfanylphenyl)methyl]propanedioic acid |
| SMILES | CSc1ccc(CC(C)(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C12H14O4S/c1-12(10(13)14,11(15)16)7-8-3-5-9(17-2)6-4-8/h3-6H,7H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | NYVWUWXTVGLHQE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|