C13H19NO4 — CID 146079454
(4-tert-butylphenyl)methanamine;oxalic acid (PubChem CID 146079454) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (4-tert-butylphenyl)methanamine;oxalic acid.
| Compound Name | (4-tert-butylphenyl)methanamine;oxalic acid |
|---|---|
| PubChem CID | 146079454 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (4-tert-butylphenyl)methanamine;oxalic acid |
| SMILES | CC(C)(C)c1ccc(CN)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H17N.C2H2O4/c1-11(2,3)10-6-4-9(8-12)5-7-10;3-1(4)2(5)6/h4-7H,8,12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | PDUYTNSISZSTGX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|