C10H13N2O4S- — CID 174773408
1-(aminomethyl)-4-[1-carboxy-1-(sulfinatoamino)ethyl]benzene (PubChem CID 174773408) has the molecular formula C10H13N2O4S- and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-(aminomethyl)-4-[1-carboxy-1-(sulfinatoamino)ethyl]benzene.
| Compound Name | 1-(aminomethyl)-4-[1-carboxy-1-(sulfinatoamino)ethyl]benzene |
|---|---|
| PubChem CID | 174773408 |
| Molecular Formula | C10H13N2O4S- |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 1-(aminomethyl)-4-[1-carboxy-1-(sulfinatoamino)ethyl]benzene |
| SMILES | CC(NS(=O)[O-])(C(=O)O)c1ccc(CN)cc1 |
| InChI | InChI=1S/C10H14N2O4S/c1-10(9(13)14,12-17(15)16)8-4-2-7(6-11)3-5-8/h2-5,12H,6,11H2,1H3,(H,13,14)(H,15,16)/p-1 |
| InChIKey | XRRLCMGYTVXWRH-UHFFFAOYSA-M |
| XLogP | -0.17 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|