C20H21F3NO4S- — CID 175018765
1-tert-butyl-4-[2-carboxy-1-(sulfinatoamino)-1-[4-(trifluoromethyl)phenyl]ethyl]benzene (PubChem CID 175018765) has the molecular formula C20H21F3NO4S- and a molecular weight of 428.45 g/mol. Its IUPAC name is 1-tert-butyl-4-[2-carboxy-1-(sulfinatoamino)-1-[4-(trifluoromethyl)phenyl]ethyl]benzene.
| Compound Name | 1-tert-butyl-4-[2-carboxy-1-(sulfinatoamino)-1-[4-(trifluoromethyl)phenyl]ethyl]benzene |
|---|---|
| PubChem CID | 175018765 |
| Molecular Formula | C20H21F3NO4S- |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 1-tert-butyl-4-[2-carboxy-1-(sulfinatoamino)-1-[4-(trifluoromethyl)phenyl]ethyl]benzene |
| SMILES | CC(C)(C)c1ccc(C(CC(=O)O)(NS(=O)[O-])c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H22F3NO4S/c1-18(2,3)13-4-6-14(7-5-13)19(12-17(25)26,24-29(27)28)15-8-10-16(11-9-15)20(21,22)23/h4-11,24H,12H2,1-3H3,(H,25,26)(H,27,28)/p-1 |
| InChIKey | YRBPRXWMAZXPSE-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|