C15H23NO2S — CID 64687774
tert-butyl 2-[cyclopropyl(thiophen-3-ylmethyl)amino]propanoate (PubChem CID 64687774) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is tert-butyl 2-[cyclopropyl(thiophen-3-ylmethyl)amino]propanoate.
| Compound Name | tert-butyl 2-[cyclopropyl(thiophen-3-ylmethyl)amino]propanoate |
|---|---|
| PubChem CID | 64687774 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl 2-[cyclopropyl(thiophen-3-ylmethyl)amino]propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C15H23NO2S/c1-11(14(17)18-15(2,3)4)16(13-5-6-13)9-12-7-8-19-10-12/h7-8,10-11,13H,5-6,9H2,1-4H3 |
| InChIKey | JHXHUGGESLPSLO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |