C20H30N2O6 — CID 11794942
benzyl 2-[butyl-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]oxyacetate (PubChem CID 11794942) has the molecular formula C20H30N2O6 and a molecular weight of 394.47 g/mol. Its IUPAC name is benzyl 2-[butyl-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]oxyacetate.
| Compound Name | benzyl 2-[butyl-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]oxyacetate |
|---|---|
| PubChem CID | 11794942 |
| Molecular Formula | C20H30N2O6 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | benzyl 2-[butyl-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]oxyacetate |
| SMILES | CCCCN(C(=O)OCC(=O)OCc1ccccc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30N2O6/c1-6-7-13-22(21(5)18(24)28-20(2,3)4)19(25)27-15-17(23)26-14-16-11-9-8-10-12-16/h8-12H,6-7,13-15H2,1-5H3 |
| InChIKey | UQISZQYFFFERHH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|