C24H32FN3O4 — CID 70870441
tert-butyl N-[2-(N-ethyl-4-fluoroanilino)ethyl]-N-[methyl(phenylmethoxycarbonyl)amino]carbamate (PubChem CID 70870441) has the molecular formula C24H32FN3O4 and a molecular weight of 445.54 g/mol. Its IUPAC name is tert-butyl N-[2-(N-ethyl-4-fluoroanilino)ethyl]-N-[methyl(phenylmethoxycarbonyl)amino]carbamate.
| Compound Name | tert-butyl N-[2-(N-ethyl-4-fluoroanilino)ethyl]-N-[methyl(phenylmethoxycarbonyl)amino]carbamate |
|---|---|
| PubChem CID | 70870441 |
| Molecular Formula | C24H32FN3O4 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | tert-butyl N-[2-(N-ethyl-4-fluoroanilino)ethyl]-N-[methyl(phenylmethoxycarbonyl)amino]carbamate |
| SMILES | CCN(CCN(C(=O)OC(C)(C)C)N(C)C(=O)OCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H32FN3O4/c1-6-27(21-14-12-20(25)13-15-21)16-17-28(23(30)32-24(2,3)4)26(5)22(29)31-18-19-10-8-7-9-11-19/h7-15H,6,16-18H2,1-5H3 |
| InChIKey | AAQRDSIYQUJQTI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|