C22H33NO6 — CID 91580702
2-[tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxy-2-methylheptanoic acid (PubChem CID 91580702) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxy-2-methylheptanoic acid.
| Compound Name | 2-[tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 91580702 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-[tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxy-2-methylheptanoic acid |
| SMILES | CCCCCC(C)(OC(=O)N(CC(=O)OCc1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C22H33NO6/c1-6-7-11-14-22(5,19(25)26)29-20(27)23(21(2,3)4)15-18(24)28-16-17-12-9-8-10-13-17/h8-10,12-13H,6-7,11,14-16H2,1-5H3,(H,25,26) |
| InChIKey | YUPDWMYJIXTHKI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|