C20H28INO6 — CID 54194877
iodomethyl 3-[2-[tert-butyl(phenylmethoxycarbonyl)amino]acetyl]oxy-2,2-dimethylpropanoate (PubChem CID 54194877) has the molecular formula C20H28INO6 and a molecular weight of 505.35 g/mol. Its IUPAC name is iodomethyl 3-[2-[tert-butyl(phenylmethoxycarbonyl)amino]acetyl]oxy-2,2-dimethylpropanoate.
| Compound Name | iodomethyl 3-[2-[tert-butyl(phenylmethoxycarbonyl)amino]acetyl]oxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54194877 |
| Molecular Formula | C20H28INO6 |
| Molecular Weight | 505.35 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | iodomethyl 3-[2-[tert-butyl(phenylmethoxycarbonyl)amino]acetyl]oxy-2,2-dimethylpropanoate |
| SMILES | CC(C)(COC(=O)CN(C(=O)OCc1ccccc1)C(C)(C)C)C(=O)OCI |
| InChI | InChI=1S/C20H28INO6/c1-19(2,3)22(18(25)26-12-15-9-7-6-8-10-15)11-16(23)27-13-20(4,5)17(24)28-14-21/h6-10H,11-14H2,1-5H3 |
| InChIKey | PLCHCOXMLHPJJW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|