C26H33NO6 — CID 66675139
[tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl 4-tert-butylbenzoate (PubChem CID 66675139) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is [tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl 4-tert-butylbenzoate.
| Compound Name | [tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 66675139 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | [tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OCOC(=O)N(CC(=O)OCc2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H33NO6/c1-25(2,3)21-14-12-20(13-15-21)23(29)32-18-33-24(30)27(26(4,5)6)16-22(28)31-17-19-10-8-7-9-11-19/h7-15H,16-18H2,1-6H3 |
| InChIKey | UEQGAHXEVWZJGH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|