C22H31NO6 — CID 66674601
[tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl cyclohexanecarboxylate (PubChem CID 66674601) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is [tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl cyclohexanecarboxylate.
| Compound Name | [tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 66674601 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | [tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl cyclohexanecarboxylate |
| SMILES | CC(C)(C)N(CC(=O)OCc1ccccc1)C(=O)OCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C22H31NO6/c1-22(2,3)23(14-19(24)27-15-17-10-6-4-7-11-17)21(26)29-16-28-20(25)18-12-8-5-9-13-18/h4,6-7,10-11,18H,5,8-9,12-16H2,1-3H3 |
| InChIKey | SWRSUNWTIDSKTE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|