C29H31NO6 — CID 66674674
[tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl 2,2-diphenylacetate (PubChem CID 66674674) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is [tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl 2,2-diphenylacetate.
| Compound Name | [tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl 2,2-diphenylacetate |
|---|---|
| PubChem CID | 66674674 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | [tert-butyl-(2-oxo-2-phenylmethoxyethyl)carbamoyl]oxymethyl 2,2-diphenylacetate |
| SMILES | CC(C)(C)N(CC(=O)OCc1ccccc1)C(=O)OCOC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31NO6/c1-29(2,3)30(19-25(31)34-20-22-13-7-4-8-14-22)28(33)36-21-35-27(32)26(23-15-9-5-10-16-23)24-17-11-6-12-18-24/h4-18,26H,19-21H2,1-3H3 |
| InChIKey | WLUCVOHOKAMMSJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|