C18H27N2O4+ — CID 91054392
4-O-benzyl 1-O-tert-butyl 1-aminopiperidin-1-ium-1,4-dicarboxylate (PubChem CID 91054392) has the molecular formula C18H27N2O4+ and a molecular weight of 335.42 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl 1-aminopiperidin-1-ium-1,4-dicarboxylate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl 1-aminopiperidin-1-ium-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91054392 |
| Molecular Formula | C18H27N2O4+ |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl 1-aminopiperidin-1-ium-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[N+]1(N)CCC(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N2O4/c1-18(2,3)24-17(22)20(19)11-9-15(10-12-20)16(21)23-13-14-7-5-4-6-8-14/h4-8,15H,9-13,19H2,1-3H3/q+1 |
| InChIKey | ASRDJHVHTBQEHG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|