C31H39F3N2O8 — CID 166463533
benzyl 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1-[2-(phenylmethoxycarbonylamino)ethyl]piperidin-1-ium-4-carboxylate;2,2,2-trifluoroacetate (PubChem CID 166463533) has the molecular formula C31H39F3N2O8 and a molecular weight of 624.65 g/mol. Its IUPAC name is benzyl 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1-[2-(phenylmethoxycarbonylamino)ethyl]piperidin-1-ium-4-carboxylate;2,2,2-trifluoroacetate.
| Compound Name | benzyl 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1-[2-(phenylmethoxycarbonylamino)ethyl]piperidin-1-ium-4-carboxylate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 166463533 |
| Molecular Formula | C31H39F3N2O8 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | benzyl 1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1-[2-(phenylmethoxycarbonylamino)ethyl]piperidin-1-ium-4-carboxylate;2,2,2-trifluoroacetate |
| SMILES | CC(C)(C)OC(=O)C[N+]1(CCNC(=O)OCc2ccccc2)CCC(C(=O)OCc2ccccc2)CC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C29H38N2O6.C2HF3O2/c1-29(2,3)37-26(32)20-31(19-16-30-28(34)36-22-24-12-8-5-9-13-24)17-14-25(15-18-31)27(33)35-21-23-10-6-4-7-11-23;3-2(4,5)1(6)7/h4-13,25H,14-22H2,1-3H3;(H,6,7) |
| InChIKey | HQHANDDQFFEATN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|