C21H30NO4+ — CID 91072170
2-O-benzyl 1-O-tert-butyl 1-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ium-1,2-dicarboxylate (PubChem CID 91072170) has the molecular formula C21H30NO4+ and a molecular weight of 360.47 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl 1-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ium-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl 1-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ium-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91072170 |
| Molecular Formula | C21H30NO4+ |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl 1-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-ium-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[N+]1(C)C(C(=O)OCc2ccccc2)CC2CCCC21 |
| InChI | InChI=1S/C21H30NO4/c1-21(2,3)26-20(24)22(4)17-12-8-11-16(17)13-18(22)19(23)25-14-15-9-6-5-7-10-15/h5-7,9-10,16-18H,8,11-14H2,1-4H3/q+1 |
| InChIKey | ZCXGQXXMEXSVSU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|