C23H27NO4 — CID 14654390
2-O-benzyl 4-O-tert-butyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate (PubChem CID 14654390) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-O-benzyl 4-O-tert-butyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate.
| Compound Name | 2-O-benzyl 4-O-tert-butyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 14654390 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-O-benzyl 4-O-tert-butyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1C[C@@H](C(=O)OCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H27NO4/c1-23(2,3)28-22(26)20-14-19(24(20)15-17-10-6-4-7-11-17)21(25)27-16-18-12-8-5-9-13-18/h4-13,19-20H,14-16H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | USUHELSGQOGRJL-VQTJNVASSA-N |
| XLogP | 3.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |