C14H17NO4 — CID 14654381
dimethyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate (PubChem CID 14654381) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is dimethyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 14654381 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | dimethyl (2S,4R)-1-benzylazetidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](C(=O)OC)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c1-18-13(16)11-8-12(14(17)19-2)15(11)9-10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3/t11-,12+ |
| InChIKey | COJVYCMOVXNWAM-TXEJJXNPSA-N |
| XLogP | 0.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |