C19H27NO3 — CID 11415866
tert-butyl (2R,5S)-1-benzyl-5-ethenyl-4-(hydroxymethyl)pyrrolidine-2-carboxylate (PubChem CID 11415866) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl (2R,5S)-1-benzyl-5-ethenyl-4-(hydroxymethyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R,5S)-1-benzyl-5-ethenyl-4-(hydroxymethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11415866 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | tert-butyl (2R,5S)-1-benzyl-5-ethenyl-4-(hydroxymethyl)pyrrolidine-2-carboxylate |
| SMILES | C=C[C@H]1C(CO)C[C@H](C(=O)OC(C)(C)C)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-5-16-15(13-21)11-17(18(22)23-19(2,3)4)20(16)12-14-9-7-6-8-10-14/h5-10,15-17,21H,1,11-13H2,2-4H3/t15?,16-,17+/m0/s1 |
| InChIKey | BDQGRNXLZLHCNI-LRUHZDSUSA-N |
| XLogP | 2.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|