C35H45NO3Si — CID 173225233
tert-butyl (2R,4S,5R)-1-benzyl-4-tert-butyl-5-(diphenylsilyloxymethyl)-5-ethenylpyrrolidine-2-carboxylate (PubChem CID 173225233) has the molecular formula C35H45NO3Si and a molecular weight of 555.84 g/mol. Its IUPAC name is tert-butyl (2R,4S,5R)-1-benzyl-4-tert-butyl-5-(diphenylsilyloxymethyl)-5-ethenylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R,4S,5R)-1-benzyl-4-tert-butyl-5-(diphenylsilyloxymethyl)-5-ethenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 173225233 |
| Molecular Formula | C35H45NO3Si |
| Molecular Weight | 555.84 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | tert-butyl (2R,4S,5R)-1-benzyl-4-tert-butyl-5-(diphenylsilyloxymethyl)-5-ethenylpyrrolidine-2-carboxylate |
| SMILES | C=C[C@]1(CO[SiH](c2ccccc2)c2ccccc2)[C@H](C(C)(C)C)C[C@H](C(=O)OC(C)(C)C)N1Cc1ccccc1 |
| InChI | InChI=1S/C35H45NO3Si/c1-8-35(26-38-40(28-20-14-10-15-21-28)29-22-16-11-17-23-29)31(33(2,3)4)24-30(32(37)39-34(5,6)7)36(35)25-27-18-12-9-13-19-27/h8-23,30-31,40H,1,24-26H2,2-7H3/t30-,31+,35+/m1/s1 |
| InChIKey | RRMHDANBEBLXBB-ZODNTCIQSA-N |
| XLogP | 5.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.84 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|