C27H37NO4Si — CID 173256595
tert-butyl (3R,5S)-5-tert-butyl-3-(diphenylsilyloxymethyl)-3-methyl-2-oxopyrrolidine-1-carboxylate (PubChem CID 173256595) has the molecular formula C27H37NO4Si and a molecular weight of 467.68 g/mol. Its IUPAC name is tert-butyl (3R,5S)-5-tert-butyl-3-(diphenylsilyloxymethyl)-3-methyl-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-5-tert-butyl-3-(diphenylsilyloxymethyl)-3-methyl-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173256595 |
| Molecular Formula | C27H37NO4Si |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | tert-butyl (3R,5S)-5-tert-butyl-3-(diphenylsilyloxymethyl)-3-methyl-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@](C)(CO[SiH](c2ccccc2)c2ccccc2)C[C@H]1C(C)(C)C |
| InChI | InChI=1S/C27H37NO4Si/c1-25(2,3)22-18-27(7,23(29)28(22)24(30)32-26(4,5)6)19-31-33(20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,22,33H,18-19H2,1-7H3/t22-,27+/m0/s1 |
| InChIKey | AKMMLNWKHDKXJX-WXVAWEFUSA-N |
| XLogP | 4.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|