C21H29NO4 — CID 12042087
tert-butyl (2R,4R,5S)-4-(acetyloxymethyl)-1-benzyl-5-ethenylpyrrolidine-2-carboxylate (PubChem CID 12042087) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl (2R,4R,5S)-4-(acetyloxymethyl)-1-benzyl-5-ethenylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R,4R,5S)-4-(acetyloxymethyl)-1-benzyl-5-ethenylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 12042087 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | tert-butyl (2R,4R,5S)-4-(acetyloxymethyl)-1-benzyl-5-ethenylpyrrolidine-2-carboxylate |
| SMILES | C=C[C@H]1[C@H](COC(C)=O)C[C@H](C(=O)OC(C)(C)C)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H29NO4/c1-6-18-17(14-25-15(2)23)12-19(20(24)26-21(3,4)5)22(18)13-16-10-8-7-9-11-16/h6-11,17-19H,1,12-14H2,2-5H3/t17-,18-,19+/m0/s1 |
| InChIKey | GCFNNLRUVVYGQC-GBESFXJTSA-N |
| XLogP | 3.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|