C13H17NO3 — CID 12030471
[(2R,3S)-1-benzyl-3-(hydroxymethyl)aziridin-2-yl]methyl acetate (PubChem CID 12030471) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is [(2R,3S)-1-benzyl-3-(hydroxymethyl)aziridin-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-1-benzyl-3-(hydroxymethyl)aziridin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 12030471 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | [(2R,3S)-1-benzyl-3-(hydroxymethyl)aziridin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@@H](CO)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c1-10(16)17-9-13-12(8-15)14(13)7-11-5-3-2-4-6-11/h2-6,12-13,15H,7-9H2,1H3/t12-,13+,14?/m1/s1 |
| InChIKey | LIBCDJXEEDFRCD-AMIUJLCOSA-N |
| XLogP | 0.79 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|