C18H19NO2 — CID 12030469
[(2R,3R)-1-benzyl-3-phenylaziridin-2-yl]methyl acetate (PubChem CID 12030469) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is [(2R,3R)-1-benzyl-3-phenylaziridin-2-yl]methyl acetate.
| Compound Name | [(2R,3R)-1-benzyl-3-phenylaziridin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 12030469 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | [(2R,3R)-1-benzyl-3-phenylaziridin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-14(20)21-13-17-18(16-10-6-3-7-11-16)19(17)12-15-8-4-2-5-9-15/h2-11,17-18H,12-13H2,1H3/t17-,18+,19?/m0/s1 |
| InChIKey | STUYGUAKZCMKIB-PAMZHZACSA-N |
| XLogP | 3.18 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|