C17H21NO4 — CID 102494427
[(3R,6R)-3-acetyloxy-1-benzyl-3,6-dihydro-2H-pyridin-6-yl]methyl acetate (PubChem CID 102494427) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is [(3R,6R)-3-acetyloxy-1-benzyl-3,6-dihydro-2H-pyridin-6-yl]methyl acetate.
| Compound Name | [(3R,6R)-3-acetyloxy-1-benzyl-3,6-dihydro-2H-pyridin-6-yl]methyl acetate |
|---|---|
| PubChem CID | 102494427 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | [(3R,6R)-3-acetyloxy-1-benzyl-3,6-dihydro-2H-pyridin-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C=C[C@@H](OC(C)=O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-13(19)21-12-16-8-9-17(22-14(2)20)11-18(16)10-15-6-4-3-5-7-15/h3-9,16-17H,10-12H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | APRVQQIYULWSIX-IAGOWNOFSA-N |
| XLogP | 1.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|