C27H31NO8 — CID 11179499
[(3R,3aS,4R,5S,6S,6aR)-4,6-diacetyloxy-1-benzyl-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazol-3-yl]methyl acetate (PubChem CID 11179499) has the molecular formula C27H31NO8 and a molecular weight of 497.54 g/mol. Its IUPAC name is [(3R,3aS,4R,5S,6S,6aR)-4,6-diacetyloxy-1-benzyl-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazol-3-yl]methyl acetate.
| Compound Name | [(3R,3aS,4R,5S,6S,6aR)-4,6-diacetyloxy-1-benzyl-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazol-3-yl]methyl acetate |
|---|---|
| PubChem CID | 11179499 |
| Molecular Formula | C27H31NO8 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | [(3R,3aS,4R,5S,6S,6aR)-4,6-diacetyloxy-1-benzyl-5-phenylmethoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazol-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1ON(Cc2ccccc2)[C@H]2[C@H](OC(C)=O)[C@@H](OCc3ccccc3)[C@H](OC(C)=O)[C@H]21 |
| InChI | InChI=1S/C27H31NO8/c1-17(29)32-16-22-23-24(28(36-22)14-20-10-6-4-7-11-20)26(35-19(3)31)27(25(23)34-18(2)30)33-15-21-12-8-5-9-13-21/h4-13,22-27H,14-16H2,1-3H3/t22-,23-,24+,25+,26-,27-/m0/s1 |
| InChIKey | VFAOEHLURSDTNM-NVWBJHIXSA-N |
| XLogP | 2.81 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|