C16H23NO2 — CID 715182
[(2S,3R,4S)-1-benzyl-2,3-dimethylpiperidin-4-yl] acetate (PubChem CID 715182) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is [(2S,3R,4S)-1-benzyl-2,3-dimethylpiperidin-4-yl] acetate.
| Compound Name | [(2S,3R,4S)-1-benzyl-2,3-dimethylpiperidin-4-yl] acetate |
|---|---|
| PubChem CID | 715182 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | [(2S,3R,4S)-1-benzyl-2,3-dimethylpiperidin-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCN(Cc2ccccc2)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C16H23NO2/c1-12-13(2)17(10-9-16(12)19-14(3)18)11-15-7-5-4-6-8-15/h4-8,12-13,16H,9-11H2,1-3H3/t12-,13+,16+/m1/s1 |
| InChIKey | CESFOVNVFNXRAX-WWGRRREGSA-N |
| XLogP | 2.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |