C12H16FN — CID 126557725
(2R,3R)-1-benzyl-3-fluoro-2-methylpyrrolidine (PubChem CID 126557725) has the molecular formula C12H16FN and a molecular weight of 193.27 g/mol. Its IUPAC name is (2R,3R)-1-benzyl-3-fluoro-2-methylpyrrolidine.
| Compound Name | (2R,3R)-1-benzyl-3-fluoro-2-methylpyrrolidine |
|---|---|
| PubChem CID | 126557725 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (2R,3R)-1-benzyl-3-fluoro-2-methylpyrrolidine |
| SMILES | C[C@@H]1[C@H](F)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C12H16FN/c1-10-12(13)7-8-14(10)9-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3/t10-,12-/m1/s1 |
| InChIKey | FDDGHFYYQNILDK-ZYHUDNBSSA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |