C13H19NO — CID 118558682
(2S,3S)-4-benzyl-2,3-dimethylmorpholine (PubChem CID 118558682) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (2S,3S)-4-benzyl-2,3-dimethylmorpholine.
| Compound Name | (2S,3S)-4-benzyl-2,3-dimethylmorpholine |
|---|---|
| PubChem CID | 118558682 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (2S,3S)-4-benzyl-2,3-dimethylmorpholine |
| SMILES | C[C@@H]1OCCN(Cc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C13H19NO/c1-11-12(2)15-9-8-14(11)10-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | BLWKKFHAEBJAEQ-RYUDHWBXSA-N |
| XLogP | 2.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |