C19H23NO — CID 140974143
(2R,3S,5S)-4-benzyl-2,3-dimethyl-5-phenylmorpholine (PubChem CID 140974143) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (2R,3S,5S)-4-benzyl-2,3-dimethyl-5-phenylmorpholine.
| Compound Name | (2R,3S,5S)-4-benzyl-2,3-dimethyl-5-phenylmorpholine |
|---|---|
| PubChem CID | 140974143 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (2R,3S,5S)-4-benzyl-2,3-dimethyl-5-phenylmorpholine |
| SMILES | C[C@H]1OC[C@H](c2ccccc2)N(Cc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C19H23NO/c1-15-16(2)21-14-19(18-11-7-4-8-12-18)20(15)13-17-9-5-3-6-10-17/h3-12,15-16,19H,13-14H2,1-2H3/t15-,16+,19+/m0/s1 |
| InChIKey | AFPGFRJWBCFJLW-FRQCXROJSA-N |
| XLogP | 4.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |