C18H20ClN — CID 53344124
(2S,3S,4S)-1-benzyl-2-(chloromethyl)-4-methyl-3-phenylazetidine (PubChem CID 53344124) has the molecular formula C18H20ClN and a molecular weight of 285.82 g/mol. Its IUPAC name is (2S,3S,4S)-1-benzyl-2-(chloromethyl)-4-methyl-3-phenylazetidine.
| Compound Name | (2S,3S,4S)-1-benzyl-2-(chloromethyl)-4-methyl-3-phenylazetidine |
|---|---|
| PubChem CID | 53344124 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (2S,3S,4S)-1-benzyl-2-(chloromethyl)-4-methyl-3-phenylazetidine |
| SMILES | C[C@H]1[C@H](c2ccccc2)[C@@H](CCl)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H20ClN/c1-14-18(16-10-6-3-7-11-16)17(12-19)20(14)13-15-8-4-2-5-9-15/h2-11,14,17-18H,12-13H2,1H3/t14-,17+,18+/m0/s1 |
| InChIKey | LRKUMAALFUONQB-BMGDILEWSA-N |
| XLogP | 4.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|