C20H25N — CID 10039279
(2S,6S)-1-benzyl-2,6-dimethyl-4-phenylpiperidine (PubChem CID 10039279) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is (2S,6S)-1-benzyl-2,6-dimethyl-4-phenylpiperidine.
| Compound Name | (2S,6S)-1-benzyl-2,6-dimethyl-4-phenylpiperidine |
|---|---|
| PubChem CID | 10039279 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | (2S,6S)-1-benzyl-2,6-dimethyl-4-phenylpiperidine |
| SMILES | C[C@H]1CC(c2ccccc2)C[C@H](C)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H25N/c1-16-13-20(19-11-7-4-8-12-19)14-17(2)21(16)15-18-9-5-3-6-10-18/h3-12,16-17,20H,13-15H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | FWFLFOPLSFGUFJ-IRXDYDNUSA-N |
| XLogP | 4.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |