C20H25NO — CID 11392285
2-[(2R,4S,6R)-2-methyl-4,6-diphenylpiperidin-1-yl]ethanol (PubChem CID 11392285) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[(2R,4S,6R)-2-methyl-4,6-diphenylpiperidin-1-yl]ethanol.
| Compound Name | 2-[(2R,4S,6R)-2-methyl-4,6-diphenylpiperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 11392285 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[(2R,4S,6R)-2-methyl-4,6-diphenylpiperidin-1-yl]ethanol |
| SMILES | C[C@@H]1C[C@H](c2ccccc2)C[C@H](c2ccccc2)N1CCO |
| InChI | InChI=1S/C20H25NO/c1-16-14-19(17-8-4-2-5-9-17)15-20(21(16)12-13-22)18-10-6-3-7-11-18/h2-11,16,19-20,22H,12-15H2,1H3/t16-,19+,20-/m1/s1 |
| InChIKey | ZIWLGEJRMOBELO-LSTHTHJFSA-N |
| XLogP | 3.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |