C13H17NO — CID 15365754
1-(2-methyl-4-phenylpyrrolidin-1-yl)ethanone (PubChem CID 15365754) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-(2-methyl-4-phenylpyrrolidin-1-yl)ethanone.
| Compound Name | 1-(2-methyl-4-phenylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 15365754 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-(2-methyl-4-phenylpyrrolidin-1-yl)ethanone |
| SMILES | CC(=O)N1CC(c2ccccc2)CC1C |
| InChI | InChI=1S/C13H17NO/c1-10-8-13(9-14(10)11(2)15)12-6-4-3-5-7-12/h3-7,10,13H,8-9H2,1-2H3 |
| InChIKey | BMQZPCRCLMHOMO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |