C18H19NO3 — CID 57185513
(2R,4R)-2-methyl-4-(4-phenoxyphenyl)pyrrolidine-1-carboxylic acid (PubChem CID 57185513) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (2R,4R)-2-methyl-4-(4-phenoxyphenyl)pyrrolidine-1-carboxylic acid.
| Compound Name | (2R,4R)-2-methyl-4-(4-phenoxyphenyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 57185513 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2R,4R)-2-methyl-4-(4-phenoxyphenyl)pyrrolidine-1-carboxylic acid |
| SMILES | C[C@@H]1C[C@H](c2ccc(Oc3ccccc3)cc2)CN1C(=O)O |
| InChI | InChI=1S/C18H19NO3/c1-13-11-15(12-19(13)18(20)21)14-7-9-17(10-8-14)22-16-5-3-2-4-6-16/h2-10,13,15H,11-12H2,1H3,(H,20,21)/t13-,15+/m1/s1 |
| InChIKey | BECFJLUYYXSOPE-HIFRSBDPSA-N |
| XLogP | 4.33 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |