C15H19F2NO — CID 122157842
2-fluoro-1-[4-(4-fluorophenyl)-2-methylpyrrolidin-1-yl]-2-methylpropan-1-one (PubChem CID 122157842) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-fluoro-1-[4-(4-fluorophenyl)-2-methylpyrrolidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 2-fluoro-1-[4-(4-fluorophenyl)-2-methylpyrrolidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 122157842 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-fluoro-1-[4-(4-fluorophenyl)-2-methylpyrrolidin-1-yl]-2-methylpropan-1-one |
| SMILES | CC1CC(c2ccc(F)cc2)CN1C(=O)C(C)(C)F |
| InChI | InChI=1S/C15H19F2NO/c1-10-8-12(11-4-6-13(16)7-5-11)9-18(10)14(19)15(2,3)17/h4-7,10,12H,8-9H2,1-3H3 |
| InChIKey | AHXULHAOWLUJCK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |