C19H24BNO2 — CID 58724375
[2-(hydroxymethyl)-4,6-diphenylpiperidin-1-yl]-methylborinic acid (PubChem CID 58724375) has the molecular formula C19H24BNO2 and a molecular weight of 309.22 g/mol. Its IUPAC name is [2-(hydroxymethyl)-4,6-diphenylpiperidin-1-yl]-methylborinic acid.
| Compound Name | [2-(hydroxymethyl)-4,6-diphenylpiperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 58724375 |
| Molecular Formula | C19H24BNO2 |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | [2-(hydroxymethyl)-4,6-diphenylpiperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1C(CO)CC(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C19H24BNO2/c1-20(23)21-18(14-22)12-17(15-8-4-2-5-9-15)13-19(21)16-10-6-3-7-11-16/h2-11,17-19,22-23H,12-14H2,1H3 |
| InChIKey | RYZWNRBENCHNFW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|