C12H16O2 — CID 14135723
5-phenylcyclohexane-1,3-diol (PubChem CID 14135723) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-phenylcyclohexane-1,3-diol.
| Compound Name | 5-phenylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 14135723 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 5-phenylcyclohexane-1,3-diol |
| SMILES | OC1CC(O)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C12H16O2/c13-11-6-10(7-12(14)8-11)9-4-2-1-3-5-9/h1-5,10-14H,6-8H2 |
| InChIKey | NOOSTNOTQHTTLU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |