C12H16O2 — CID 134981811
(2S,4S,6S)-2-methyl-6-phenyloxan-4-ol (PubChem CID 134981811) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (2S,4S,6S)-2-methyl-6-phenyloxan-4-ol.
| Compound Name | (2S,4S,6S)-2-methyl-6-phenyloxan-4-ol |
|---|---|
| PubChem CID | 134981811 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (2S,4S,6S)-2-methyl-6-phenyloxan-4-ol |
| SMILES | C[C@H]1C[C@H](O)C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C12H16O2/c1-9-7-11(13)8-12(14-9)10-5-3-2-4-6-10/h2-6,9,11-13H,7-8H2,1H3/t9-,11-,12-/m0/s1 |
| InChIKey | QCOGSGXAKPVMRI-DLOVCJGASA-N |
| XLogP | 2.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |