C11H14O2 — CID 130461475
(2S)-2-methyl-6-phenyl-1,4-dioxane (PubChem CID 130461475) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (2S)-2-methyl-6-phenyl-1,4-dioxane.
| Compound Name | (2S)-2-methyl-6-phenyl-1,4-dioxane |
|---|---|
| PubChem CID | 130461475 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2S)-2-methyl-6-phenyl-1,4-dioxane |
| SMILES | C[C@H]1COCC(c2ccccc2)O1 |
| InChI | InChI=1S/C11H14O2/c1-9-7-12-8-11(13-9)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-,11?/m0/s1 |
| InChIKey | SMCWBHYSQWIHAT-FTNKSUMCSA-N |
| XLogP | 2.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |