C10H12O2 — CID 10374766
(2S,4S)-2-methyl-4-phenyl-1,3-dioxolane (PubChem CID 10374766) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (2S,4S)-2-methyl-4-phenyl-1,3-dioxolane.
| Compound Name | (2S,4S)-2-methyl-4-phenyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10374766 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (2S,4S)-2-methyl-4-phenyl-1,3-dioxolane |
| SMILES | C[C@H]1OC[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C10H12O2/c1-8-11-7-10(12-8)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3/t8-,10+/m0/s1 |
| InChIKey | YPPGSWWESBCSCT-WCBMZHEXSA-N |
| XLogP | 2.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |