C10H12O2 — CID 97052112
(3S,5R)-5-phenyloxolan-3-ol (PubChem CID 97052112) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (3S,5R)-5-phenyloxolan-3-ol.
| Compound Name | (3S,5R)-5-phenyloxolan-3-ol |
|---|---|
| PubChem CID | 97052112 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (3S,5R)-5-phenyloxolan-3-ol |
| SMILES | O[C@@H]1CO[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C10H12O2/c11-9-6-10(12-7-9)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2/t9-,10+/m0/s1 |
| InChIKey | CLLMDDBRVJALNV-VHSXEESVSA-N |
| XLogP | 1.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |