C11H14O2 — CID 67658519
(2S,4S)-2-phenyloxan-4-ol (PubChem CID 67658519) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (2S,4S)-2-phenyloxan-4-ol.
| Compound Name | (2S,4S)-2-phenyloxan-4-ol |
|---|---|
| PubChem CID | 67658519 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2S,4S)-2-phenyloxan-4-ol |
| SMILES | O[C@H]1CCO[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C11H14O2/c12-10-6-7-13-11(8-10)9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-,11-/m0/s1 |
| InChIKey | VPXLNWRTGPPGRS-QWRGUYRKSA-N |
| XLogP | 1.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |