C10H11BrO2 — CID 23253721
(2S,3S,5R)-3-bromo-5-phenyloxolan-2-ol (PubChem CID 23253721) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is (2S,3S,5R)-3-bromo-5-phenyloxolan-2-ol.
| Compound Name | (2S,3S,5R)-3-bromo-5-phenyloxolan-2-ol |
|---|---|
| PubChem CID | 23253721 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | (2S,3S,5R)-3-bromo-5-phenyloxolan-2-ol |
| SMILES | O[C@H]1O[C@@H](c2ccccc2)C[C@@H]1Br |
| InChI | InChI=1S/C10H11BrO2/c11-8-6-9(13-10(8)12)7-4-2-1-3-5-7/h1-5,8-10,12H,6H2/t8-,9+,10-/m0/s1 |
| InChIKey | MBQWDKHNLXFFKD-AEJSXWLSSA-N |
| XLogP | 2.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|