C21H20O2 — CID 101086399
(2S,4R,6R)-2-naphthalen-2-yl-6-phenyloxan-4-ol (PubChem CID 101086399) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2S,4R,6R)-2-naphthalen-2-yl-6-phenyloxan-4-ol.
| Compound Name | (2S,4R,6R)-2-naphthalen-2-yl-6-phenyloxan-4-ol |
|---|---|
| PubChem CID | 101086399 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (2S,4R,6R)-2-naphthalen-2-yl-6-phenyloxan-4-ol |
| SMILES | O[C@H]1C[C@@H](c2ccc3ccccc3c2)O[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C21H20O2/c22-19-13-20(16-7-2-1-3-8-16)23-21(14-19)18-11-10-15-6-4-5-9-17(15)12-18/h1-12,19-22H,13-14H2/t19-,20-,21+/m1/s1 |
| InChIKey | IFBSCVYMGVQJSW-NJYVYQBISA-N |
| XLogP | 4.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |