C20H18O — CID 101344860
(2R,5R)-2-naphthalen-2-yl-5-phenyloxolane (PubChem CID 101344860) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is (2R,5R)-2-naphthalen-2-yl-5-phenyloxolane.
| Compound Name | (2R,5R)-2-naphthalen-2-yl-5-phenyloxolane |
|---|---|
| PubChem CID | 101344860 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2R,5R)-2-naphthalen-2-yl-5-phenyloxolane |
| SMILES | c1ccc([C@H]2CC[C@H](c3ccc4ccccc4c3)O2)cc1 |
| InChI | InChI=1S/C20H18O/c1-2-7-16(8-3-1)19-12-13-20(21-19)18-11-10-15-6-4-5-9-17(15)14-18/h1-11,14,19-20H,12-13H2/t19-,20-/m1/s1 |
| InChIKey | LTIUXFJPLAWEOP-WOJBJXKFSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |