C15H15FO — CID 155927148
(2S,4R)-4-fluoro-2-naphthalen-2-yloxane (PubChem CID 155927148) has the molecular formula C15H15FO and a molecular weight of 230.28 g/mol. Its IUPAC name is (2S,4R)-4-fluoro-2-naphthalen-2-yloxane.
| Compound Name | (2S,4R)-4-fluoro-2-naphthalen-2-yloxane |
|---|---|
| PubChem CID | 155927148 |
| Molecular Formula | C15H15FO |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (2S,4R)-4-fluoro-2-naphthalen-2-yloxane |
| SMILES | F[C@@H]1CCO[C@H](c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C15H15FO/c16-14-7-8-17-15(10-14)13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9,14-15H,7-8,10H2/t14-,15+/m1/s1 |
| InChIKey | DLGQDFFWROPKEK-CABCVRRESA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |